ChemImpex Boc-(S)-1-amino-2-propanol; 99% (Chiral purity); 167938-56-9; MFCD04974340, 250G

Boc-(S)-1-amino-2-propanol is a versatile compound widely utilized in the synthesis of pharmaceuticals and agrochemicals. This chiral amino alcohol serves as a crucial building block in the development of various bioactive molecules, particularly in the production of peptide-based drugs. Its unique tert-butoxycarbonyl (Boc) protecting group allows for selective reactions, making it an essential reagent in organic synthesis. Researchers appreciate its ability to enhance the solubility and stability of compounds, facilitating smoother reaction processes and improving yields.

In addition to its applications in medicinal chemistry, Boc-(S)-1-amino-2-propanol is also employed in the formulation of chiral catalysts and ligands, which are vital in asymmetric synthesis. Its favorable properties, such as high purity and excellent reactivity, make it a preferred choice among professionals in the pharmaceutical and chemical industries. With its growing relevance in drug discovery and development, this compound holds significant potential for researchers looking to innovate and improve existing methodologies.

Specifications

Safety & Regulations