ChemImpex Boc-L-Ser(Bzl)-O-CH2-Ph-CH2-COOH·DCHA; 97% (HPLC), MFCD00273514, 5G

Boc-L-Ser(Bzl)-O-CH2-Ph-CH2-COOH·DCHA is a versatile amino acid derivative that plays a crucial role in peptide synthesis and pharmaceutical development. This compound features a protected serine residue, which is essential for the formation of complex peptides and proteins. Its unique structure, including the benzyl and phenyl groups, enhances its stability and solubility, making it an ideal choice for researchers focused on drug design and development. The presence of the DCHA salt form further improves its handling and storage properties, ensuring that it remains effective in various applications.

This compound is particularly valuable in the synthesis of bioactive peptides, which are increasingly important in therapeutic applications, including cancer treatment and metabolic disorders. Researchers can leverage its properties to create more effective drug candidates with improved bioavailability and specificity. Additionally, its compatibility with various coupling reagents and methodologies allows for flexibility in synthetic routes, making it a preferred choice for both academic and industrial laboratories. With its broad applicability and advantageous characteristics, Boc-L-Ser(Bzl)-O-CH2-Ph-CH2-COOH·DCHA stands out as a key component in modern peptide chemistry.

Specifications

Safety & Regulations